C14H13ClN4OS — CID 6478878
(E)-3-(2-chlorophenyl)-N-[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 6478878) has the molecular formula C14H13ClN4OS and a molecular weight of 320.81 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6478878 |
| Molecular Formula | C14H13ClN4OS |
| Molecular Weight | 320.81 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1nnc(NC2CC2)s1 |
| InChI | InChI=1S/C14H13ClN4OS/c15-11-4-2-1-3-9(11)5-8-12(20)17-14-19-18-13(21-14)16-10-6-7-10/h1-5,8,10H,6-7H2,(H,16,18)(H,17,19,20)/b8-5+ |
| InChIKey | FURVRROGTFFXDO-VMPITWQZSA-N |
| XLogP | 3.42 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|