C14H14N4OS — CID 510289
N-[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide (PubChem CID 510289) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is N-[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 510289 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1nnc(NC2CC2)s1 |
| InChI | InChI=1S/C14H14N4OS/c19-12(9-6-10-4-2-1-3-5-10)16-14-18-17-13(20-14)15-11-7-8-11/h1-6,9,11H,7-8H2,(H,15,17)(H,16,18,19) |
| InChIKey | LNUNUHCSPZGRGF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|