C11H9N3OS — CID 732155
3-phenyl-N-(1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 732155) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 3-phenyl-N-(1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 3-phenyl-N-(1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 732155 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-phenyl-N-(1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1nncs1 |
| InChI | InChI=1S/C11H9N3OS/c15-10(13-11-14-12-8-16-11)7-6-9-4-2-1-3-5-9/h1-8H,(H,13,14,15) |
| InChIKey | PORLVXMAXNYUJD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|