C12H11N3OS — CID 4621052
3-(4-methylphenyl)-N-(1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 4621052) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-(1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(4-methylphenyl)-N-(1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4621052 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-(4-methylphenyl)-N-(1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)Nc2nncs2)cc1 |
| InChI | InChI=1S/C12H11N3OS/c1-9-2-4-10(5-3-9)6-7-11(16)14-12-15-13-8-17-12/h2-8H,1H3,(H,14,15,16) |
| InChIKey | TUHXATQMBUWWEZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|