C8H9N3OS — CID 122358747
(2E,4E)-N-(1,3,4-thiadiazol-2-yl)hexa-2,4-dienamide (PubChem CID 122358747) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is (2E,4E)-N-(1,3,4-thiadiazol-2-yl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(1,3,4-thiadiazol-2-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 122358747 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (2E,4E)-N-(1,3,4-thiadiazol-2-yl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1nncs1 |
| InChI | InChI=1S/C8H9N3OS/c1-2-3-4-5-7(12)10-8-11-9-6-13-8/h2-6H,1H3,(H,10,11,12)/b3-2+,5-4+ |
| InChIKey | OICHJQGTORJHKD-MQQKCMAXSA-N |
| XLogP | 1.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|