C14H17N3O2 — CID 47143172
(2E,4E)-N-[4-(methylcarbamoylamino)phenyl]hexa-2,4-dienamide (PubChem CID 47143172) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is (2E,4E)-N-[4-(methylcarbamoylamino)phenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[4-(methylcarbamoylamino)phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 47143172 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (2E,4E)-N-[4-(methylcarbamoylamino)phenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccc(NC(=O)NC)cc1 |
| InChI | InChI=1S/C14H17N3O2/c1-3-4-5-6-13(18)16-11-7-9-12(10-8-11)17-14(19)15-2/h3-10H,1-2H3,(H,16,18)(H2,15,17,19)/b4-3+,6-5+ |
| InChIKey | GRZYVRXOVGXHAC-VNKDHWASSA-N |
| XLogP | 2.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|