C16H22N2O3S — CID 75533656
(2E,4E)-N-[4-(butylsulfonylamino)phenyl]hexa-2,4-dienamide (PubChem CID 75533656) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is (2E,4E)-N-[4-(butylsulfonylamino)phenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[4-(butylsulfonylamino)phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 75533656 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (2E,4E)-N-[4-(butylsulfonylamino)phenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccc(NS(=O)(=O)CCCC)cc1 |
| InChI | InChI=1S/C16H22N2O3S/c1-3-5-7-8-16(19)17-14-9-11-15(12-10-14)18-22(20,21)13-6-4-2/h3,5,7-12,18H,4,6,13H2,1-2H3,(H,17,19)/b5-3+,8-7+ |
| InChIKey | OGYXODDCDHCZCS-VSAQMIDASA-N |
| XLogP | 3.30 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|