C16H20N2O2 — CID 26679975
(2E,4E)-N-[4-(2-methylpropanoylamino)phenyl]hexa-2,4-dienamide (PubChem CID 26679975) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (2E,4E)-N-[4-(2-methylpropanoylamino)phenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[4-(2-methylpropanoylamino)phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 26679975 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (2E,4E)-N-[4-(2-methylpropanoylamino)phenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccc(NC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-4-5-6-7-15(19)17-13-8-10-14(11-9-13)18-16(20)12(2)3/h4-12H,1-3H3,(H,17,19)(H,18,20)/b5-4+,7-6+ |
| InChIKey | GJDOFGJJYSTRGQ-YTXTXJHMSA-N |
| XLogP | 3.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|