C14H11N3O — CID 97377775
(2Z,4E)-N-(3,4-dicyanophenyl)hexa-2,4-dienamide (PubChem CID 97377775) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is (2Z,4E)-N-(3,4-dicyanophenyl)hexa-2,4-dienamide.
| Compound Name | (2Z,4E)-N-(3,4-dicyanophenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 97377775 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (2Z,4E)-N-(3,4-dicyanophenyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C\C(=O)Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C14H11N3O/c1-2-3-4-5-14(18)17-13-7-6-11(9-15)12(8-13)10-16/h2-8H,1H3,(H,17,18)/b3-2+,5-4- |
| InChIKey | YYWWQSWBHHGKFL-IAROGAJJSA-N |
| XLogP | 2.50 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|