C10H7N3O — CID 12938829
N-(3,4-dicyanophenyl)acetamide (PubChem CID 12938829) has the molecular formula C10H7N3O and a molecular weight of 185.19 g/mol. Its IUPAC name is N-(3,4-dicyanophenyl)acetamide.
| Compound Name | N-(3,4-dicyanophenyl)acetamide |
|---|---|
| PubChem CID | 12938829 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | N-(3,4-dicyanophenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C10H7N3O/c1-7(14)13-10-3-2-8(5-11)9(4-10)6-12/h2-4H,1H3,(H,13,14) |
| InChIKey | REYCEEFBHWADHV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |