C15H9N3O3 — CID 103944403
N-(3,4-dicyanophenyl)-3,5-dihydroxybenzamide (PubChem CID 103944403) has the molecular formula C15H9N3O3 and a molecular weight of 279.26 g/mol. Its IUPAC name is N-(3,4-dicyanophenyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(3,4-dicyanophenyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 103944403 |
| Molecular Formula | C15H9N3O3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | N-(3,4-dicyanophenyl)-3,5-dihydroxybenzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(O)cc(O)c2)cc1C#N |
| InChI | InChI=1S/C15H9N3O3/c16-7-9-1-2-12(3-11(9)8-17)18-15(21)10-4-13(19)6-14(20)5-10/h1-6,19-20H,(H,18,21) |
| InChIKey | COVQJYIHHPYSBT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |