C15H7ClIN3O — CID 103738054
3-chloro-N-(3,4-dicyanophenyl)-4-iodobenzamide (PubChem CID 103738054) has the molecular formula C15H7ClIN3O and a molecular weight of 407.60 g/mol. Its IUPAC name is 3-chloro-N-(3,4-dicyanophenyl)-4-iodobenzamide.
| Compound Name | 3-chloro-N-(3,4-dicyanophenyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 103738054 |
| Molecular Formula | C15H7ClIN3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 3-chloro-N-(3,4-dicyanophenyl)-4-iodobenzamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccc(I)c(Cl)c2)cc1C#N |
| InChI | InChI=1S/C15H7ClIN3O/c16-13-6-9(2-4-14(13)17)15(21)20-12-3-1-10(7-18)11(5-12)8-19/h1-6H,(H,20,21) |
| InChIKey | ROJZEKPLAPRNNX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|