C15H9FN4O — CID 107786862
3-amino-N-(3,4-dicyanophenyl)-4-fluorobenzamide (PubChem CID 107786862) has the molecular formula C15H9FN4O and a molecular weight of 280.26 g/mol. Its IUPAC name is 3-amino-N-(3,4-dicyanophenyl)-4-fluorobenzamide.
| Compound Name | 3-amino-N-(3,4-dicyanophenyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 107786862 |
| Molecular Formula | C15H9FN4O |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3-amino-N-(3,4-dicyanophenyl)-4-fluorobenzamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccc(F)c(N)c2)cc1C#N |
| InChI | InChI=1S/C15H9FN4O/c16-13-4-2-9(6-14(13)19)15(21)20-12-3-1-10(7-17)11(5-12)8-18/h1-6H,19H2,(H,20,21) |
| InChIKey | LZUDBRPSBNWUFV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|