C15H9ClN4O — CID 107786836
2-amino-5-chloro-N-(3,4-dicyanophenyl)benzamide (PubChem CID 107786836) has the molecular formula C15H9ClN4O and a molecular weight of 296.72 g/mol. Its IUPAC name is 2-amino-5-chloro-N-(3,4-dicyanophenyl)benzamide.
| Compound Name | 2-amino-5-chloro-N-(3,4-dicyanophenyl)benzamide |
|---|---|
| PubChem CID | 107786836 |
| Molecular Formula | C15H9ClN4O |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-amino-5-chloro-N-(3,4-dicyanophenyl)benzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(Cl)ccc2N)cc1C#N |
| InChI | InChI=1S/C15H9ClN4O/c16-11-2-4-14(19)13(6-11)15(21)20-12-3-1-9(7-17)10(5-12)8-18/h1-6H,19H2,(H,20,21) |
| InChIKey | ZKQIQQFAFBMHFT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|