C15H8FN3O2 — CID 103944404
N-(3,4-dicyanophenyl)-5-fluoro-2-hydroxybenzamide (PubChem CID 103944404) has the molecular formula C15H8FN3O2 and a molecular weight of 281.25 g/mol. Its IUPAC name is N-(3,4-dicyanophenyl)-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-(3,4-dicyanophenyl)-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 103944404 |
| Molecular Formula | C15H8FN3O2 |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | N-(3,4-dicyanophenyl)-5-fluoro-2-hydroxybenzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(F)ccc2O)cc1C#N |
| InChI | InChI=1S/C15H8FN3O2/c16-11-2-4-14(20)13(6-11)15(21)19-12-3-1-9(7-17)10(5-12)8-18/h1-6,20H,(H,19,21) |
| InChIKey | OMXRSNCYTDBDMV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |