C14H9FN2O3 — CID 114343561
N-(3-cyano-4-fluorophenyl)-2,3-dihydroxybenzamide (PubChem CID 114343561) has the molecular formula C14H9FN2O3 and a molecular weight of 272.24 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-2,3-dihydroxybenzamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114343561 |
| Molecular Formula | C14H9FN2O3 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-2,3-dihydroxybenzamide |
| SMILES | N#Cc1cc(NC(=O)c2cccc(O)c2O)ccc1F |
| InChI | InChI=1S/C14H9FN2O3/c15-11-5-4-9(6-8(11)7-16)17-14(20)10-2-1-3-12(18)13(10)19/h1-6,18-19H,(H,17,20) |
| InChIKey | IKNBAKVVUYLWEG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|