C17H11N3O5 — CID 142452732
N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-3,5-dihydroxybenzamide (PubChem CID 142452732) has the molecular formula C17H11N3O5 and a molecular weight of 337.29 g/mol. Its IUPAC name is N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-3,5-dihydroxybenzamide.
| Compound Name | N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 142452732 |
| Molecular Formula | C17H11N3O5 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-3,5-dihydroxybenzamide |
| SMILES | N#CCN1C(=O)c2ccc(NC(=O)c3cc(O)cc(O)c3)cc2C1=O |
| InChI | InChI=1S/C17H11N3O5/c18-3-4-20-16(24)13-2-1-10(7-14(13)17(20)25)19-15(23)9-5-11(21)8-12(22)6-9/h1-2,5-8,21-22H,4H2,(H,19,23) |
| InChIKey | PWFQQBUWSJMDEH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|