C17H11N3O4 — CID 142452714
N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-3-hydroxybenzamide (PubChem CID 142452714) has the molecular formula C17H11N3O4 and a molecular weight of 321.29 g/mol. Its IUPAC name is N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-3-hydroxybenzamide.
| Compound Name | N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 142452714 |
| Molecular Formula | C17H11N3O4 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-3-hydroxybenzamide |
| SMILES | N#CCN1C(=O)c2ccc(NC(=O)c3cccc(O)c3)cc2C1=O |
| InChI | InChI=1S/C17H11N3O4/c18-6-7-20-16(23)13-5-4-11(9-14(13)17(20)24)19-15(22)10-2-1-3-12(21)8-10/h1-5,8-9,21H,7H2,(H,19,22) |
| InChIKey | WDAZJFVWUHICPU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|