C22H16N2O4 — CID 4194063
N-(2-methyl-1,3-dioxoisoindol-5-yl)-3-phenoxybenzamide (PubChem CID 4194063) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-3-phenoxybenzamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-3-phenoxybenzamide |
|---|---|
| PubChem CID | 4194063 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-3-phenoxybenzamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3cccc(Oc4ccccc4)c3)cc2C1=O |
| InChI | InChI=1S/C22H16N2O4/c1-24-21(26)18-11-10-15(13-19(18)22(24)27)23-20(25)14-6-5-9-17(12-14)28-16-7-3-2-4-8-16/h2-13H,1H3,(H,23,25) |
| InChIKey | GUEJOGVVNBKEDK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|