C17H12N2O5 — CID 4174312
2-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamoyl]benzoic acid (PubChem CID 4174312) has the molecular formula C17H12N2O5 and a molecular weight of 324.29 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamoyl]benzoic acid.
| Compound Name | 2-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 4174312 |
| Molecular Formula | C17H12N2O5 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamoyl]benzoic acid |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3ccccc3C(=O)O)cc2C1=O |
| InChI | InChI=1S/C17H12N2O5/c1-19-15(21)11-7-6-9(8-13(11)16(19)22)18-14(20)10-4-2-3-5-12(10)17(23)24/h2-8H,1H3,(H,18,20)(H,23,24) |
| InChIKey | FKEUMPHYTOSQCO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|