C14H11N3O3 — CID 110461124
N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-pyrrole-2-carboxamide (PubChem CID 110461124) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 110461124 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-pyrrole-2-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3ccc[nH]3)cc2C1=O |
| InChI | InChI=1S/C14H11N3O3/c1-17-13(19)9-5-4-8(7-10(9)14(17)20)16-12(18)11-3-2-6-15-11/h2-7,15H,1H3,(H,16,18) |
| InChIKey | OQOIIEQUPFKUPR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|