C18H11FN2O3S — CID 31508762
4-fluoro-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1-benzothiophene-2-carboxamide (PubChem CID 31508762) has the molecular formula C18H11FN2O3S and a molecular weight of 354.36 g/mol. Its IUPAC name is 4-fluoro-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 31508762 |
| Molecular Formula | C18H11FN2O3S |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 4-fluoro-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1-benzothiophene-2-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3cc4c(F)cccc4s3)cc2C1=O |
| InChI | InChI=1S/C18H11FN2O3S/c1-21-17(23)10-6-5-9(7-11(10)18(21)24)20-16(22)15-8-12-13(19)3-2-4-14(12)25-15/h2-8H,1H3,(H,20,22) |
| InChIKey | LVZXMVYINWIEKU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|