C14H10N2O3S2 — CID 107020171
N-(2-methyl-1,3-dioxoisoindol-5-yl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107020171) has the molecular formula C14H10N2O3S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107020171 |
| Molecular Formula | C14H10N2O3S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3cc(S)cs3)cc2C1=O |
| InChI | InChI=1S/C14H10N2O3S2/c1-16-13(18)9-3-2-7(4-10(9)14(16)19)15-12(17)11-5-8(20)6-21-11/h2-6,20H,1H3,(H,15,17) |
| InChIKey | KIIPLHISXNFUPU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|