C14H12N4O3 — CID 43642778
4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-pyrrole-2-carboxamide (PubChem CID 43642778) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43642778 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-pyrrole-2-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3cc(N)c[nH]3)cc2C1=O |
| InChI | InChI=1S/C14H12N4O3/c1-18-13(20)9-3-2-8(5-10(9)14(18)21)17-12(19)11-4-7(15)6-16-11/h2-6,16H,15H2,1H3,(H,17,19) |
| InChIKey | RIALJSXCQYYMGT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|