C13H9N5O — CID 107786819
4-amino-N-(3,4-dicyanophenyl)-1H-pyrrole-2-carboxamide (PubChem CID 107786819) has the molecular formula C13H9N5O and a molecular weight of 251.25 g/mol. Its IUPAC name is 4-amino-N-(3,4-dicyanophenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(3,4-dicyanophenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107786819 |
| Molecular Formula | C13H9N5O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-amino-N-(3,4-dicyanophenyl)-1H-pyrrole-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(N)c[nH]2)cc1C#N |
| InChI | InChI=1S/C13H9N5O/c14-5-8-1-2-11(3-9(8)6-15)18-13(19)12-4-10(16)7-17-12/h1-4,7,17H,16H2,(H,18,19) |
| InChIKey | WXLZYSZGLWQIGG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |