C16H10N4O7 — CID 4536464
N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,5-dinitrobenzamide (PubChem CID 4536464) has the molecular formula C16H10N4O7 and a molecular weight of 370.28 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,5-dinitrobenzamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4536464 |
| Molecular Formula | C16H10N4O7 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,5-dinitrobenzamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2C1=O |
| InChI | InChI=1S/C16H10N4O7/c1-18-15(22)12-3-2-9(6-13(12)16(18)23)17-14(21)8-4-10(19(24)25)7-11(5-8)20(26)27/h2-7H,1H3,(H,17,21) |
| InChIKey | LDQYJSAEUGGDGX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|