C28H16N4O8 — CID 5207304
4-nitro-N-[6-[(4-nitrobenzoyl)amino]-9,10-dioxoanthracen-2-yl]benzamide (PubChem CID 5207304) has the molecular formula C28H16N4O8 and a molecular weight of 536.46 g/mol. Its IUPAC name is 4-nitro-N-[6-[(4-nitrobenzoyl)amino]-9,10-dioxoanthracen-2-yl]benzamide.
| Compound Name | 4-nitro-N-[6-[(4-nitrobenzoyl)amino]-9,10-dioxoanthracen-2-yl]benzamide |
|---|---|
| PubChem CID | 5207304 |
| Molecular Formula | C28H16N4O8 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 4-nitro-N-[6-[(4-nitrobenzoyl)amino]-9,10-dioxoanthracen-2-yl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)c1ccc(NC(=O)c3ccc([N+](=O)[O-])cc3)cc1C2=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H16N4O8/c33-25-22-12-6-18(30-28(36)16-3-9-20(10-4-16)32(39)40)14-24(22)26(34)21-11-5-17(13-23(21)25)29-27(35)15-1-7-19(8-2-15)31(37)38/h1-14H,(H,29,35)(H,30,36) |
| InChIKey | JKTPTGKTNJOEMO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|