C21H12N2O5 — CID 3422751
N-(9,10-dioxoanthracen-2-yl)-4-nitrobenzamide (PubChem CID 3422751) has the molecular formula C21H12N2O5 and a molecular weight of 372.34 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-4-nitrobenzamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 3422751 |
| Molecular Formula | C21H12N2O5 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)c1ccccc1C2=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H12N2O5/c24-19-15-3-1-2-4-16(15)20(25)18-11-13(7-10-17(18)19)22-21(26)12-5-8-14(9-6-12)23(27)28/h1-11H,(H,22,26) |
| InChIKey | NHUIBDGUZYKBPL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|