C13H8N4O7 — CID 5185042
N-(3,4-dinitrophenyl)-4-nitrobenzamide (PubChem CID 5185042) has the molecular formula C13H8N4O7 and a molecular weight of 332.23 g/mol. Its IUPAC name is N-(3,4-dinitrophenyl)-4-nitrobenzamide.
| Compound Name | N-(3,4-dinitrophenyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 5185042 |
| Molecular Formula | C13H8N4O7 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | N-(3,4-dinitrophenyl)-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H8N4O7/c18-13(8-1-4-10(5-2-8)15(19)20)14-9-3-6-11(16(21)22)12(7-9)17(23)24/h1-7H,(H,14,18) |
| InChIKey | JTFMMVDRSCILOG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 158.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|