C13H9N3O6 — CID 86673990
N-(3,4-dinitrophenyl)-4-hydroxybenzamide (PubChem CID 86673990) has the molecular formula C13H9N3O6 and a molecular weight of 303.23 g/mol. Its IUPAC name is N-(3,4-dinitrophenyl)-4-hydroxybenzamide.
| Compound Name | N-(3,4-dinitrophenyl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 86673990 |
| Molecular Formula | C13H9N3O6 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-(3,4-dinitrophenyl)-4-hydroxybenzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H9N3O6/c17-10-4-1-8(2-5-10)13(18)14-9-3-6-11(15(19)20)12(7-9)16(21)22/h1-7,17H,(H,14,18) |
| InChIKey | GKZKMYUBCCEXRL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|