C18H19N5O5 — CID 86673957
N-(3,4-dinitrophenyl)-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 86673957) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is N-(3,4-dinitrophenyl)-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-(3,4-dinitrophenyl)-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 86673957 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-(3,4-dinitrophenyl)-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3ccc([N+](=O)[O-])c([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C18H19N5O5/c1-20-8-10-21(11-9-20)15-5-2-13(3-6-15)18(24)19-14-4-7-16(22(25)26)17(12-14)23(27)28/h2-7,12H,8-11H2,1H3,(H,19,24) |
| InChIKey | VTMRGRJEKTVXLV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|