C17H12F2N2O3S — CID 42030668
4-(difluoromethylsulfanyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide (PubChem CID 42030668) has the molecular formula C17H12F2N2O3S and a molecular weight of 362.36 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide |
|---|---|
| PubChem CID | 42030668 |
| Molecular Formula | C17H12F2N2O3S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)benzamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3ccc(SC(F)F)cc3)cc2C1=O |
| InChI | InChI=1S/C17H12F2N2O3S/c1-21-15(23)12-7-4-10(8-13(12)16(21)24)20-14(22)9-2-5-11(6-3-9)25-17(18)19/h2-8,17H,1H3,(H,20,22) |
| InChIKey | SIONTWBUEVMGSV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|