C15H12N4O6 — CID 26906332
N-[4-(methylcarbamoyl)phenyl]-3,5-dinitrobenzamide (PubChem CID 26906332) has the molecular formula C15H12N4O6 and a molecular weight of 344.28 g/mol. Its IUPAC name is N-[4-(methylcarbamoyl)phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-(methylcarbamoyl)phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 26906332 |
| Molecular Formula | C15H12N4O6 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-[4-(methylcarbamoyl)phenyl]-3,5-dinitrobenzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C15H12N4O6/c1-16-14(20)9-2-4-11(5-3-9)17-15(21)10-6-12(18(22)23)8-13(7-10)19(24)25/h2-8H,1H3,(H,16,20)(H,17,21) |
| InChIKey | UKDULPWNWGUIMG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|