C17H15N3O8 — CID 19169304
2-methoxyethyl 4-[(3,5-dinitrobenzoyl)amino]benzoate (PubChem CID 19169304) has the molecular formula C17H15N3O8 and a molecular weight of 389.32 g/mol. Its IUPAC name is 2-methoxyethyl 4-[(3,5-dinitrobenzoyl)amino]benzoate.
| Compound Name | 2-methoxyethyl 4-[(3,5-dinitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 19169304 |
| Molecular Formula | C17H15N3O8 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-methoxyethyl 4-[(3,5-dinitrobenzoyl)amino]benzoate |
| SMILES | COCCOC(=O)c1ccc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H15N3O8/c1-27-6-7-28-17(22)11-2-4-13(5-3-11)18-16(21)12-8-14(19(23)24)10-15(9-12)20(25)26/h2-5,8-10H,6-7H2,1H3,(H,18,21) |
| InChIKey | RJMCYSWHYZJVLT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|