C36H47N7O6 — CID 122202498
1-N,3-N-bis[4-[3-(diethylamino)propylcarbamoyl]phenyl]-5-nitrobenzene-1,3-dicarboxamide (PubChem CID 122202498) has the molecular formula C36H47N7O6 and a molecular weight of 673.82 g/mol. Its IUPAC name is 1-N,3-N-bis[4-[3-(diethylamino)propylcarbamoyl]phenyl]-5-nitrobenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-[3-(diethylamino)propylcarbamoyl]phenyl]-5-nitrobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 122202498 |
| Molecular Formula | C36H47N7O6 |
| Molecular Weight | 673.82 g/mol |
| Exact Mass | 673.36 |
| IUPAC Name | 1-N,3-N-bis[4-[3-(diethylamino)propylcarbamoyl]phenyl]-5-nitrobenzene-1,3-dicarboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc(NC(=O)c2cc(C(=O)Nc3ccc(C(=O)NCCCN(CC)CC)cc3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C36H47N7O6/c1-5-41(6-2)21-9-19-37-33(44)26-11-15-30(16-12-26)39-35(46)28-23-29(25-32(24-28)43(48)49)36(47)40-31-17-13-27(14-18-31)34(45)38-20-10-22-42(7-3)8-4/h11-18,23-25H,5-10,19-22H2,1-4H3,(H,37,44)(H,38,45)(H,39,46)(H,40,47) |
| InChIKey | IWUIYENLVQUSPG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 166.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|