C17H14N6O10 — CID 4148153
N-[3-[(3,5-dinitrobenzoyl)amino]propyl]-3,5-dinitrobenzamide (PubChem CID 4148153) has the molecular formula C17H14N6O10 and a molecular weight of 462.33 g/mol. Its IUPAC name is N-[3-[(3,5-dinitrobenzoyl)amino]propyl]-3,5-dinitrobenzamide.
| Compound Name | N-[3-[(3,5-dinitrobenzoyl)amino]propyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4148153 |
| Molecular Formula | C17H14N6O10 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[3-[(3,5-dinitrobenzoyl)amino]propyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NCCCNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14N6O10/c24-16(10-4-12(20(26)27)8-13(5-10)21(28)29)18-2-1-3-19-17(25)11-6-14(22(30)31)9-15(7-11)23(32)33/h4-9H,1-3H2,(H,18,24)(H,19,25) |
| InChIKey | FSYHGEOBLUVQAV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 230.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|