C28H33N11O14 — CID 44585320
N-[2-[[2-[3-[3-[[2-[[2-[(3,5-dinitrobenzoyl)amino]acetyl]amino]acetyl]amino]propylamino]propylamino]-2-oxoethyl]amino]-2-oxoethyl]-3,5-dinitrobenzamide (PubChem CID 44585320) has the molecular formula C28H33N11O14 and a molecular weight of 747.63 g/mol. Its IUPAC name is N-[2-[[2-[3-[3-[[2-[[2-[(3,5-dinitrobenzoyl)amino]acetyl]amino]acetyl]amino]propylamino]propylamino]-2-oxoethyl]amino]-2-oxoethyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-[[2-[3-[3-[[2-[[2-[(3,5-dinitrobenzoyl)amino]acetyl]amino]acetyl]amino]propylamino]propylamino]-2-oxoethyl]amino]-2-oxoethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 44585320 |
| Molecular Formula | C28H33N11O14 |
| Molecular Weight | 747.63 g/mol |
| Exact Mass | 747.22 |
| IUPAC Name | N-[2-[[2-[3-[3-[[2-[[2-[(3,5-dinitrobenzoyl)amino]acetyl]amino]acetyl]amino]propylamino]propylamino]-2-oxoethyl]amino]-2-oxoethyl]-3,5-dinitrobenzamide |
| SMILES | O=C(CNC(=O)CNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)NCCCNCCCNC(=O)CNC(=O)CNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H33N11O14/c40-23(13-32-25(42)15-34-27(44)17-7-19(36(46)47)11-20(8-17)37(48)49)30-5-1-3-29-4-2-6-31-24(41)14-33-26(43)16-35-28(45)18-9-21(38(50)51)12-22(10-18)39(52)53/h7-12,29H,1-6,13-16H2,(H,30,40)(H,31,41)(H,32,42)(H,33,43)(H,34,44)(H,35,45) |
| InChIKey | DXLGXPCTGDBKPF-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 359.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.63 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|