C18H25N3O4 — CID 46461541
N-[2-(3-cyclohexylpropylamino)-2-oxoethyl]-3-nitrobenzamide (PubChem CID 46461541) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[2-(3-cyclohexylpropylamino)-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-(3-cyclohexylpropylamino)-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 46461541 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[2-(3-cyclohexylpropylamino)-2-oxoethyl]-3-nitrobenzamide |
| SMILES | O=C(CNC(=O)c1cccc([N+](=O)[O-])c1)NCCCC1CCCCC1 |
| InChI | InChI=1S/C18H25N3O4/c22-17(19-11-5-8-14-6-2-1-3-7-14)13-20-18(23)15-9-4-10-16(12-15)21(24)25/h4,9-10,12,14H,1-3,5-8,11,13H2,(H,19,22)(H,20,23) |
| InChIKey | WZNMYMCWFCFAHM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|