C13H13N5O9 — CID 44585321
2-[[2-[[2-[(3,5-dinitrobenzoyl)amino]acetyl]amino]acetyl]amino]acetic acid (PubChem CID 44585321) has the molecular formula C13H13N5O9 and a molecular weight of 383.27 g/mol. Its IUPAC name is 2-[[2-[[2-[(3,5-dinitrobenzoyl)amino]acetyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[(3,5-dinitrobenzoyl)amino]acetyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 44585321 |
| Molecular Formula | C13H13N5O9 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[[2-[[2-[(3,5-dinitrobenzoyl)amino]acetyl]amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)CNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13N5O9/c19-10(15-6-12(21)22)4-14-11(20)5-16-13(23)7-1-8(17(24)25)3-9(2-7)18(26)27/h1-3H,4-6H2,(H,14,20)(H,15,19)(H,16,23)(H,21,22) |
| InChIKey | UAFHQCJHLOZNKP-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 210.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|