C16H12N6O10 — CID 4600343
N-[2-[(3,5-dinitrobenzoyl)amino]ethyl]-3,5-dinitrobenzamide (PubChem CID 4600343) has the molecular formula C16H12N6O10 and a molecular weight of 448.30 g/mol. Its IUPAC name is N-[2-[(3,5-dinitrobenzoyl)amino]ethyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-[(3,5-dinitrobenzoyl)amino]ethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4600343 |
| Molecular Formula | C16H12N6O10 |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | N-[2-[(3,5-dinitrobenzoyl)amino]ethyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NCCNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12N6O10/c23-15(9-3-11(19(25)26)7-12(4-9)20(27)28)17-1-2-18-16(24)10-5-13(21(29)30)8-14(6-10)22(31)32/h3-8H,1-2H2,(H,17,23)(H,18,24) |
| InChIKey | XQGYWUXUCHFKRN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 230.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|