C12H13N3O6 — CID 119171145
2-[3-[(4-nitrobenzoyl)amino]propanoylamino]acetic acid (PubChem CID 119171145) has the molecular formula C12H13N3O6 and a molecular weight of 295.25 g/mol. Its IUPAC name is 2-[3-[(4-nitrobenzoyl)amino]propanoylamino]acetic acid.
| Compound Name | 2-[3-[(4-nitrobenzoyl)amino]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 119171145 |
| Molecular Formula | C12H13N3O6 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-[3-[(4-nitrobenzoyl)amino]propanoylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)CCNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H13N3O6/c16-10(14-7-11(17)18)5-6-13-12(19)8-1-3-9(4-2-8)15(20)21/h1-4H,5-7H2,(H,13,19)(H,14,16)(H,17,18) |
| InChIKey | RMOJDOOPGXMEEO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|