C17H15ClN4O5 — CID 2678141
N-[3-[2-(4-chlorobenzoyl)hydrazinyl]-3-oxopropyl]-4-nitrobenzamide (PubChem CID 2678141) has the molecular formula C17H15ClN4O5 and a molecular weight of 390.78 g/mol. Its IUPAC name is N-[3-[2-(4-chlorobenzoyl)hydrazinyl]-3-oxopropyl]-4-nitrobenzamide.
| Compound Name | N-[3-[2-(4-chlorobenzoyl)hydrazinyl]-3-oxopropyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 2678141 |
| Molecular Formula | C17H15ClN4O5 |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-[3-[2-(4-chlorobenzoyl)hydrazinyl]-3-oxopropyl]-4-nitrobenzamide |
| SMILES | O=C(CCNC(=O)c1ccc([N+](=O)[O-])cc1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN4O5/c18-13-5-1-12(2-6-13)17(25)21-20-15(23)9-10-19-16(24)11-3-7-14(8-4-11)22(26)27/h1-8H,9-10H2,(H,19,24)(H,20,23)(H,21,25) |
| InChIKey | LMOIMZFRRTXBSW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|