C14H19ClN4O5 — CID 4634092
4-chloro-N-[3-(diethylamino)propyl]-3,5-dinitrobenzamide (PubChem CID 4634092) has the molecular formula C14H19ClN4O5 and a molecular weight of 358.78 g/mol. Its IUPAC name is 4-chloro-N-[3-(diethylamino)propyl]-3,5-dinitrobenzamide.
| Compound Name | 4-chloro-N-[3-(diethylamino)propyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4634092 |
| Molecular Formula | C14H19ClN4O5 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-chloro-N-[3-(diethylamino)propyl]-3,5-dinitrobenzamide |
| SMILES | CCN(CC)CCCNC(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H19ClN4O5/c1-3-17(4-2)7-5-6-16-14(20)10-8-11(18(21)22)13(15)12(9-10)19(23)24/h8-9H,3-7H2,1-2H3,(H,16,20) |
| InChIKey | YMQNFJYOPADDOD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|