C18H28N4O4 — CID 110839509
N-[3-(diethylamino)propyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 110839509) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[3-(diethylamino)propyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 110839509 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | N-[3-(diethylamino)propyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H28N4O4/c1-3-20(4-2)9-5-8-19-18(23)15-6-7-16(17(14-15)22(24)25)21-10-12-26-13-11-21/h6-7,14H,3-5,8-13H2,1-2H3,(H,19,23) |
| InChIKey | MSRKQLYOWMWQQL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|