C15H19N3O6 — CID 100650393
(2S)-2-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]butanoic acid (PubChem CID 100650393) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is (2S)-2-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]butanoic acid.
| Compound Name | (2S)-2-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 100650393 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2S)-2-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C15H19N3O6/c1-2-11(15(20)21)16-14(19)10-3-4-12(13(9-10)18(22)23)17-5-7-24-8-6-17/h3-4,9,11H,2,5-8H2,1H3,(H,16,19)(H,20,21)/t11-/m0/s1 |
| InChIKey | IPLVXDXEPSLYOU-NSHDSACASA-N |
| XLogP | 1.02 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|