C15H20ClN3O5 — CID 4634267
N,N-dibutyl-4-chloro-3,5-dinitrobenzamide (PubChem CID 4634267) has the molecular formula C15H20ClN3O5 and a molecular weight of 357.79 g/mol. Its IUPAC name is N,N-dibutyl-4-chloro-3,5-dinitrobenzamide.
| Compound Name | N,N-dibutyl-4-chloro-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4634267 |
| Molecular Formula | C15H20ClN3O5 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N,N-dibutyl-4-chloro-3,5-dinitrobenzamide |
| SMILES | CCCCN(CCCC)C(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H20ClN3O5/c1-3-5-7-17(8-6-4-2)15(20)11-9-12(18(21)22)14(16)13(10-11)19(23)24/h9-10H,3-8H2,1-2H3 |
| InChIKey | BXBHYAMITGTMCG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|