C15H20F3NO — CID 63188520
N,N-dibutyl-3,4,5-trifluorobenzamide (PubChem CID 63188520) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is N,N-dibutyl-3,4,5-trifluorobenzamide.
| Compound Name | N,N-dibutyl-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 63188520 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N,N-dibutyl-3,4,5-trifluorobenzamide |
| SMILES | CCCCN(CCCC)C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H20F3NO/c1-3-5-7-19(8-6-4-2)15(20)11-9-12(16)14(18)13(17)10-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | NNLHYYQGJAWPMG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|