C13H15BrF3NO2 — CID 80659762
N-(2-bromoethyl)-N-butyl-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 80659762) has the molecular formula C13H15BrF3NO2 and a molecular weight of 354.17 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-butyl-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(2-bromoethyl)-N-butyl-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 80659762 |
| Molecular Formula | C13H15BrF3NO2 |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-(2-bromoethyl)-N-butyl-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | CCCCN(CCBr)C(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C13H15BrF3NO2/c1-2-3-5-18(6-4-14)13(20)8-7-9(15)11(17)12(19)10(8)16/h7,19H,2-6H2,1H3 |
| InChIKey | DRKVRSJEMOGKBX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|