C15H22F2N2O — CID 61095334
5-amino-N,N-dibutyl-2,4-difluorobenzamide (PubChem CID 61095334) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is 5-amino-N,N-dibutyl-2,4-difluorobenzamide.
| Compound Name | 5-amino-N,N-dibutyl-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 61095334 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 5-amino-N,N-dibutyl-2,4-difluorobenzamide |
| SMILES | CCCCN(CCCC)C(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C15H22F2N2O/c1-3-5-7-19(8-6-4-2)15(20)11-9-14(18)13(17)10-12(11)16/h9-10H,3-8,18H2,1-2H3 |
| InChIKey | BOGSMOHGGGTFBS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|