C12H16F2N2O — CID 61091185
5-amino-N-butyl-2,4-difluoro-N-methylbenzamide (PubChem CID 61091185) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 5-amino-N-butyl-2,4-difluoro-N-methylbenzamide.
| Compound Name | 5-amino-N-butyl-2,4-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 61091185 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 5-amino-N-butyl-2,4-difluoro-N-methylbenzamide |
| SMILES | CCCCN(C)C(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C12H16F2N2O/c1-3-4-5-16(2)12(17)8-6-11(15)10(14)7-9(8)13/h6-7H,3-5,15H2,1-2H3 |
| InChIKey | DTEGFNCNAPHZSX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|